C11H22O2 — CID 76963946
(4S,5S)-2-hexyl-4,5-dimethyl-1,3-dioxolane (PubChem CID 76963946) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (4S,5S)-2-hexyl-4,5-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-2-hexyl-4,5-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 76963946 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (4S,5S)-2-hexyl-4,5-dimethyl-1,3-dioxolane |
| SMILES | CCCCCCC1O[C@@H](C)[C@H](C)O1 |
| InChI | InChI=1S/C11H22O2/c1-4-5-6-7-8-11-12-9(2)10(3)13-11/h9-11H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | MTNLKAOONWIMIT-UWVGGRQHSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|