C16H32O4 — CID 10708512
3,6-diheptyl-1,2,4,5-tetraoxane (PubChem CID 10708512) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is 3,6-diheptyl-1,2,4,5-tetraoxane.
| Compound Name | 3,6-diheptyl-1,2,4,5-tetraoxane |
|---|---|
| PubChem CID | 10708512 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 3,6-diheptyl-1,2,4,5-tetraoxane |
| SMILES | CCCCCCCC1OOC(CCCCCCC)OO1 |
| InChI | InChI=1S/C16H32O4/c1-3-5-7-9-11-13-15-17-19-16(20-18-15)14-12-10-8-6-4-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | JMSOFAQFFYOQOQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|