C13H26O2 — CID 76959551
(2R,4S)-4-methyl-2-nonyl-1,3-dioxolane (PubChem CID 76959551) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is (2R,4S)-4-methyl-2-nonyl-1,3-dioxolane.
| Compound Name | (2R,4S)-4-methyl-2-nonyl-1,3-dioxolane |
|---|---|
| PubChem CID | 76959551 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (2R,4S)-4-methyl-2-nonyl-1,3-dioxolane |
| SMILES | CCCCCCCCC[C@@H]1OC[C@H](C)O1 |
| InChI | InChI=1S/C13H26O2/c1-3-4-5-6-7-8-9-10-13-14-11-12(2)15-13/h12-13H,3-11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | SJLDHKPBFAHHSI-QWHCGFSZSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|