About 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol
3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol (PubChem CID 154524660) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol |
| PubChem CID | 154524660 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol |
| SMILES | CC1COC(CCCO)O1 |
| InChI | InChI=1S/C7H14O3/c1-6-5-9-7(10-6)3-2-4-8/h6-8H,2-5H2,1H3 |
| InChIKey | HMQCOMBCVOLYTE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol?
The IUPAC name of 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol (CID 154524660) is 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol.
What is the SMILES notation for 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol?
The canonical SMILES for 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol is CC1COC(CCCO)O1.
What is the InChIKey of 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol?
The InChIKey is HMQCOMBCVOLYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3/c1-6-5-9-7(10-6)3-2-4-8/h6-8H,2-5H2,1H3.
What are the key properties of 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol?
3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol has a molecular weight of 146.19 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-1,3-dioxolan-2-yl)propan-1-ol is sourced from PubChem (CID 154524660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).