C7H12O3 — CID 20507445
3-(4-methyl-1,3-dioxolan-2-yl)propanal (PubChem CID 20507445) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-(4-methyl-1,3-dioxolan-2-yl)propanal.
| Compound Name | 3-(4-methyl-1,3-dioxolan-2-yl)propanal |
|---|---|
| PubChem CID | 20507445 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 3-(4-methyl-1,3-dioxolan-2-yl)propanal |
| SMILES | CC1COC(CCC=O)O1 |
| InChI | InChI=1S/C7H12O3/c1-6-5-9-7(10-6)3-2-4-8/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | XETPZADFKGQTCN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|