C5H9BrO2 — CID 130671884
(4S)-2-(bromomethyl)-4-methyl-1,3-dioxolane (PubChem CID 130671884) has the molecular formula C5H9BrO2 and a molecular weight of 181.03 g/mol. Its IUPAC name is (4S)-2-(bromomethyl)-4-methyl-1,3-dioxolane.
| Compound Name | (4S)-2-(bromomethyl)-4-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 130671884 |
| Molecular Formula | C5H9BrO2 |
| Molecular Weight | 181.03 g/mol |
| Exact Mass | 179.98 |
| IUPAC Name | (4S)-2-(bromomethyl)-4-methyl-1,3-dioxolane |
| SMILES | C[C@H]1COC(CBr)O1 |
| InChI | InChI=1S/C5H9BrO2/c1-4-3-7-5(2-6)8-4/h4-5H,2-3H2,1H3/t4-,5?/m0/s1 |
| InChIKey | DUQGHFJLJLUFMA-ROLXFIACSA-N |
| XLogP | 1.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.03 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|