C5H11NO3 — CID 134925790
O-[(4-methyl-1,3-dioxolan-2-yl)methyl]hydroxylamine (PubChem CID 134925790) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is O-[(4-methyl-1,3-dioxolan-2-yl)methyl]hydroxylamine.
| Compound Name | O-[(4-methyl-1,3-dioxolan-2-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 134925790 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | O-[(4-methyl-1,3-dioxolan-2-yl)methyl]hydroxylamine |
| SMILES | CC1COC(CON)O1 |
| InChI | InChI=1S/C5H11NO3/c1-4-2-7-5(9-4)3-8-6/h4-5H,2-3,6H2,1H3 |
| InChIKey | WTEPOBHGZYQKRU-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|