C6H10O3 — CID 54408460
2-[(4R)-4-methyl-1,3-dioxolan-2-yl]acetaldehyde (PubChem CID 54408460) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is 2-[(4R)-4-methyl-1,3-dioxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(4R)-4-methyl-1,3-dioxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 54408460 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 2-[(4R)-4-methyl-1,3-dioxolan-2-yl]acetaldehyde |
| SMILES | C[C@@H]1COC(CC=O)O1 |
| InChI | InChI=1S/C6H10O3/c1-5-4-8-6(9-5)2-3-7/h3,5-6H,2,4H2,1H3/t5-,6?/m1/s1 |
| InChIKey | VSKIDEQHKBHDKH-LWOQYNTDSA-N |
| XLogP | 0.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|