C5H9NO3 — CID 89043720
(2R,4S)-4-methyl-2-(nitrosomethyl)-1,3-dioxolane (PubChem CID 89043720) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is (2R,4S)-4-methyl-2-(nitrosomethyl)-1,3-dioxolane.
| Compound Name | (2R,4S)-4-methyl-2-(nitrosomethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 89043720 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | (2R,4S)-4-methyl-2-(nitrosomethyl)-1,3-dioxolane |
| SMILES | C[C@H]1CO[C@@H](CN=O)O1 |
| InChI | InChI=1S/C5H9NO3/c1-4-3-8-5(9-4)2-6-7/h4-5H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | XERGZIPVPOKQKJ-CRCLSJGQSA-N |
| XLogP | 0.51 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |