C10H20O2 — CID 36690472
(2S,4S)-2-hexyl-4-methyl-1,3-dioxolane (PubChem CID 36690472) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (2S,4S)-2-hexyl-4-methyl-1,3-dioxolane.
| Compound Name | (2S,4S)-2-hexyl-4-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 36690472 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (2S,4S)-2-hexyl-4-methyl-1,3-dioxolane |
| SMILES | CCCCCC[C@H]1OC[C@H](C)O1 |
| InChI | InChI=1S/C10H20O2/c1-3-4-5-6-7-10-11-8-9(2)12-10/h9-10H,3-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | GFNFPBSXMBRHRU-UWVGGRQHSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|