About 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol
3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol (PubChem CID 115094395) has the molecular formula C7H14O4
and a molecular weight of 162.18 g/mol. Its IUPAC name is 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol.
Analyze 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol?
The IUPAC name of 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol (CID 115094395) is 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol.
What is the SMILES notation for 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol?
The canonical SMILES for 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol is OCCCC1OCC(CO)O1.
What is the InChIKey of 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol?
The InChIKey is KCJYXGBEGMOMMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4/c8-3-1-2-7-10-5-6(4-9)11-7/h6-9H,1-5H2.
What are the key properties of 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol?
3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol has a molecular weight of 162.18 g/mol, XLogP of -0.51, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]propan-1-ol is sourced from PubChem (CID 115094395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).