C19H36O3 — CID 125479888
[(2S,4R)-2-[(E)-pentadec-8-enyl]-1,3-dioxolan-4-yl]methanol (PubChem CID 125479888) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is [(2S,4R)-2-[(E)-pentadec-8-enyl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(2S,4R)-2-[(E)-pentadec-8-enyl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 125479888 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | [(2S,4R)-2-[(E)-pentadec-8-enyl]-1,3-dioxolan-4-yl]methanol |
| SMILES | CCCCCC/C=C/CCCCCCC[C@H]1OC[C@@H](CO)O1 |
| InChI | InChI=1S/C19H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-21-17-18(16-20)22-19/h7-8,18-20H,2-6,9-17H2,1H3/b8-7+/t18-,19+/m1/s1 |
| InChIKey | SVTDBTSFBOAOCZ-ZSQQTYLHSA-N |
| XLogP | 4.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|