C21H40O6P- — CID 58758375
[2-[(Z)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methyl hydrogen phosphate (PubChem CID 58758375) has the molecular formula C21H40O6P- and a molecular weight of 419.52 g/mol. Its IUPAC name is [2-[(Z)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methyl hydrogen phosphate.
| Compound Name | [2-[(Z)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 58758375 |
| Molecular Formula | C21H40O6P- |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | [2-[(Z)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methyl hydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC1OCC(COP(=O)([O-])O)O1 |
| InChI | InChI=1S/C21H41O6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-25-18-20(27-21)19-26-28(22,23)24/h9-10,20-21H,2-8,11-19H2,1H3,(H2,22,23,24)/p-1/b10-9- |
| InChIKey | JYSJPJHSNZETKQ-KTKRTIGZSA-M |
| XLogP | 5.24 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|