C21H41O5PS — CID 58758371
[(2R,4R)-2-[(Z)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methoxy-dihydroxy-sulfanylidene-λ5-phosphane (PubChem CID 58758371) has the molecular formula C21H41O5PS and a molecular weight of 436.60 g/mol. Its IUPAC name is [(2R,4R)-2-[(Z)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methoxy-dihydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | [(2R,4R)-2-[(Z)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methoxy-dihydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 58758371 |
| Molecular Formula | C21H41O5PS |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [(2R,4R)-2-[(Z)-heptadec-8-enyl]-1,3-dioxolan-4-yl]methoxy-dihydroxy-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCCC/C=C\CCCCCCC[C@@H]1OC[C@H](COP(O)(O)=S)O1 |
| InChI | InChI=1S/C21H41O5PS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-18-20(26-21)19-25-27(22,23)28/h9-10,20-21H,2-8,11-19H2,1H3,(H2,22,23,28)/b10-9-/t20-,21-/m1/s1 |
| InChIKey | CAKCNWYCVFLOCK-KNLQKXEQSA-N |
| XLogP | 5.99 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|