C14H26O5 — CID 171064920
methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate (PubChem CID 171064920) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate.
| Compound Name | methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate |
|---|---|
| PubChem CID | 171064920 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate |
| SMILES | CCCCCCC[C@H]1OCC(COCC(=O)OC)O1 |
| InChI | InChI=1S/C14H26O5/c1-3-4-5-6-7-8-14-18-10-12(19-14)9-17-11-13(15)16-2/h12,14H,3-11H2,1-2H3/t12?,14-/m0/s1 |
| InChIKey | SZHUKOIMTVMYJT-PYMCNQPYSA-N |
| XLogP | 2.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|