methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate

C14H26O5 — CID 171064920

IUPACmethyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate
SMILESCCCCCCC[C@H]1OCC(COCC(=O)OC)O1
InChIInChI=1S/C14H26O5/c1-3-4-5-6-7-8-14-18-10-12(19-14)9-17-11-13(15)16-2/h12,14H,3-11H2,1-2H3/t12?,14-/m0/s1
InChIKeySZHUKOIMTVMYJT-PYMCNQPYSA-N
MW274.36 g/mol
LogP2.28
Rot. Bonds10

About methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate

methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate (PubChem CID 171064920) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate.

Molecular Properties

Compound Namemethyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate
PubChem CID171064920
Molecular FormulaC14H26O5
Molecular Weight274.36 g/mol
Exact Mass274.18
IUPAC Namemethyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate
SMILESCCCCCCC[C@H]1OCC(COCC(=O)OC)O1
InChIInChI=1S/C14H26O5/c1-3-4-5-6-7-8-14-18-10-12(19-14)9-17-11-13(15)16-2/h12,14H,3-11H2,1-2H3/t12?,14-/m0/s1
InChIKeySZHUKOIMTVMYJT-PYMCNQPYSA-N
XLogP2.28
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds10
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.36
LogP ≤ 52.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate?
The IUPAC name of methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate (CID 171064920) is methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate.
What is the SMILES notation for methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate?
The canonical SMILES for methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate is CCCCCCC[C@H]1OCC(COCC(=O)OC)O1.
What is the InChIKey of methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate?
The InChIKey is SZHUKOIMTVMYJT-PYMCNQPYSA-N. The full InChI is InChI=1S/C14H26O5/c1-3-4-5-6-7-8-14-18-10-12(19-14)9-17-11-13(15)16-2/h12,14H,3-11H2,1-2H3/t12?,14-/m0/s1.
What are the key properties of methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate?
methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate has a molecular weight of 274.36 g/mol, XLogP of 2.28, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2S)-2-heptyl-1,3-dioxolan-4-yl]methoxy]acetate is sourced from PubChem (CID 171064920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).