C18H35O3PS — CID 76673105
dihydroxy-octadeca-9,12-dienoxy-sulfanylidene-λ5-phosphane (PubChem CID 76673105) has the molecular formula C18H35O3PS and a molecular weight of 362.52 g/mol. Its IUPAC name is dihydroxy-octadeca-9,12-dienoxy-sulfanylidene-λ5-phosphane.
| Compound Name | dihydroxy-octadeca-9,12-dienoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 76673105 |
| Molecular Formula | C18H35O3PS |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | dihydroxy-octadeca-9,12-dienoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCC=CCC=CCCCCCCCCOP(O)(O)=S |
| InChI | InChI=1S/C18H35O3PS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-22(19,20)23/h6-7,9-10H,2-5,8,11-18H2,1H3,(H2,19,20,23) |
| InChIKey | GHARPDAPUPFNHH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|