C18H36O3PS- — CID 58049486
hydroxy-[(E)-octadec-9-enoxy]-oxido-sulfanylidene-λ5-phosphane (PubChem CID 58049486) has the molecular formula C18H36O3PS- and a molecular weight of 363.52 g/mol. Its IUPAC name is hydroxy-[(E)-octadec-9-enoxy]-oxido-sulfanylidene-λ5-phosphane.
| Compound Name | hydroxy-[(E)-octadec-9-enoxy]-oxido-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 58049486 |
| Molecular Formula | C18H36O3PS- |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | hydroxy-[(E)-octadec-9-enoxy]-oxido-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOP([O-])(O)=S |
| InChI | InChI=1S/C18H37O3PS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-22(19,20)23/h9-10H,2-8,11-18H2,1H3,(H2,19,20,23)/p-1/b10-9+ |
| InChIKey | DSGBMMNDXFQXBM-MDZDMXLPSA-M |
| XLogP | 5.62 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|