C20H40NO4PS — CID 122191542
(Z)-N-(2-dihydroxyphosphinothioyloxyethyl)octadec-9-enamide (PubChem CID 122191542) has the molecular formula C20H40NO4PS and a molecular weight of 421.58 g/mol. Its IUPAC name is (Z)-N-(2-dihydroxyphosphinothioyloxyethyl)octadec-9-enamide.
| Compound Name | (Z)-N-(2-dihydroxyphosphinothioyloxyethyl)octadec-9-enamide |
|---|---|
| PubChem CID | 122191542 |
| Molecular Formula | C20H40NO4PS |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (Z)-N-(2-dihydroxyphosphinothioyloxyethyl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCOP(O)(O)=S |
| InChI | InChI=1S/C20H40NO4PS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)21-18-19-25-26(23,24)27/h9-10H,2-8,11-19H2,1H3,(H,21,22)(H2,23,24,27)/b10-9- |
| InChIKey | BUQWMMIMYJHUGH-KTKRTIGZSA-N |
| XLogP | 5.37 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|