C21H43O5PS — CID 72986618
1-dihydroxyphosphinothioyloxy-3-octadec-9-enoxypropan-2-ol (PubChem CID 72986618) has the molecular formula C21H43O5PS and a molecular weight of 438.61 g/mol. Its IUPAC name is 1-dihydroxyphosphinothioyloxy-3-octadec-9-enoxypropan-2-ol.
| Compound Name | 1-dihydroxyphosphinothioyloxy-3-octadec-9-enoxypropan-2-ol |
|---|---|
| PubChem CID | 72986618 |
| Molecular Formula | C21H43O5PS |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 1-dihydroxyphosphinothioyloxy-3-octadec-9-enoxypropan-2-ol |
| SMILES | CCCCCCCCC=CCCCCCCCCOCC(O)COP(O)(O)=S |
| InChI | InChI=1S/C21H43O5PS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25-19-21(22)20-26-27(23,24)28/h9-10,21-22H,2-8,11-20H2,1H3,(H2,23,24,28) |
| InChIKey | TYNXHJZWYUFCJR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|