C25H47NO2 — CID 156756130
N,N-dimethyl-1-[2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-4-yl]methanamine (PubChem CID 156756130) has the molecular formula C25H47NO2 and a molecular weight of 393.66 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-4-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-4-yl]methanamine |
|---|---|
| PubChem CID | 156756130 |
| Molecular Formula | C25H47NO2 |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.36 |
| IUPAC Name | N,N-dimethyl-1-[2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxan-4-yl]methanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1OCCC(CN(C)C)O1 |
| InChI | InChI=1S/C25H47NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-27-22-21-24(28-25)23-26(2)3/h8-9,11-12,24-25H,4-7,10,13-23H2,1-3H3/b9-8-,12-11- |
| InChIKey | JPDKHZURJQMUMG-MURFETPASA-N |
| XLogP | 6.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|