About 2-octadec-9-enyloxirane;phosphoric acid
2-octadec-9-enyloxirane;phosphoric acid (PubChem CID 173288867) has the molecular formula C20H41O5P
and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-octadec-9-enyloxirane;phosphoric acid.
Molecular Properties
| Compound Name | 2-octadec-9-enyloxirane;phosphoric acid |
| PubChem CID | 173288867 |
| Molecular Formula | C20H41O5P |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 2-octadec-9-enyloxirane;phosphoric acid |
| SMILES | CCCCCCCCC=CCCCCCCCCC1CO1.O=P(O)(O)O |
| InChI | InChI=1S/C20H38O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19-21-20;1-5(2,3)4/h9-10,20H,2-8,11-19H2,1H3;(H3,1,2,3,4) |
| InChIKey | FVZABBHFYHNCCJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-octadec-9-enyloxirane;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octadec-9-enyloxirane;phosphoric acid?
The IUPAC name of 2-octadec-9-enyloxirane;phosphoric acid (CID 173288867) is 2-octadec-9-enyloxirane;phosphoric acid.
What is the SMILES notation for 2-octadec-9-enyloxirane;phosphoric acid?
The canonical SMILES for 2-octadec-9-enyloxirane;phosphoric acid is CCCCCCCCC=CCCCCCCCCC1CO1.O=P(O)(O)O.
What is the InChIKey of 2-octadec-9-enyloxirane;phosphoric acid?
The InChIKey is FVZABBHFYHNCCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19-21-20;1-5(2,3)4/h9-10,20H,2-8,11-19H2,1H3;(H3,1,2,3,4).
What are the key properties of 2-octadec-9-enyloxirane;phosphoric acid?
2-octadec-9-enyloxirane;phosphoric acid has a molecular weight of 392.52 g/mol, XLogP of 5.88, 16 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octadec-9-enyloxirane;phosphoric acid is sourced from PubChem (CID 173288867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).