C19H31O5PS — CID 58758385
dihydroxy-[[2-[(4-octylphenyl)methyl]-1,3-dioxolan-4-yl]methoxy]-sulfanylidene-λ5-phosphane (PubChem CID 58758385) has the molecular formula C19H31O5PS and a molecular weight of 402.49 g/mol. Its IUPAC name is dihydroxy-[[2-[(4-octylphenyl)methyl]-1,3-dioxolan-4-yl]methoxy]-sulfanylidene-λ5-phosphane.
| Compound Name | dihydroxy-[[2-[(4-octylphenyl)methyl]-1,3-dioxolan-4-yl]methoxy]-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 58758385 |
| Molecular Formula | C19H31O5PS |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | dihydroxy-[[2-[(4-octylphenyl)methyl]-1,3-dioxolan-4-yl]methoxy]-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCCCc1ccc(CC2OCC(COP(O)(O)=S)O2)cc1 |
| InChI | InChI=1S/C19H31O5PS/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)13-19-22-14-18(24-19)15-23-25(20,21)26/h9-12,18-19H,2-8,13-15H2,1H3,(H2,20,21,26) |
| InChIKey | LJHTYFPAMVKHHI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|