About octadec-9-enoic acid;oxiran-2-ylmethanol
octadec-9-enoic acid;oxiran-2-ylmethanol (PubChem CID 173054254) has the molecular formula C21H40O4
and a molecular weight of 356.55 g/mol. Its IUPAC name is octadec-9-enoic acid;oxiran-2-ylmethanol.
Molecular Properties
| Compound Name | octadec-9-enoic acid;oxiran-2-ylmethanol |
| PubChem CID | 173054254 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | octadec-9-enoic acid;oxiran-2-ylmethanol |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.OCC1CO1 |
| InChI | InChI=1S/C18H34O2.C3H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;4-1-3-2-5-3/h9-10H,2-8,11-17H2,1H3,(H,19,20);3-4H,1-2H2 |
| InChIKey | FECJXNBIOXHUJB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze octadec-9-enoic acid;oxiran-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-9-enoic acid;oxiran-2-ylmethanol?
The IUPAC name of octadec-9-enoic acid;oxiran-2-ylmethanol (CID 173054254) is octadec-9-enoic acid;oxiran-2-ylmethanol.
What is the SMILES notation for octadec-9-enoic acid;oxiran-2-ylmethanol?
The canonical SMILES for octadec-9-enoic acid;oxiran-2-ylmethanol is CCCCCCCCC=CCCCCCCCC(=O)O.OCC1CO1.
What is the InChIKey of octadec-9-enoic acid;oxiran-2-ylmethanol?
The InChIKey is FECJXNBIOXHUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2.C3H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;4-1-3-2-5-3/h9-10H,2-8,11-17H2,1H3,(H,19,20);3-4H,1-2H2.
What are the key properties of octadec-9-enoic acid;oxiran-2-ylmethanol?
octadec-9-enoic acid;oxiran-2-ylmethanol has a molecular weight of 356.55 g/mol, XLogP of 5.49, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-9-enoic acid;oxiran-2-ylmethanol is sourced from PubChem (CID 173054254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).