C7H11IO3 — CID 173452777
[2-(3-iodoprop-2-enyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 173452777) has the molecular formula C7H11IO3 and a molecular weight of 270.07 g/mol. Its IUPAC name is [2-(3-iodoprop-2-enyl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-(3-iodoprop-2-enyl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 173452777 |
| Molecular Formula | C7H11IO3 |
| Molecular Weight | 270.07 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | [2-(3-iodoprop-2-enyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | OCC1COC(CC=CI)O1 |
| InChI | InChI=1S/C7H11IO3/c8-3-1-2-7-10-5-6(4-9)11-7/h1,3,6-7,9H,2,4-5H2 |
| InChIKey | DTVUVSFFCZGPMA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.07 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|