C5H8O5 — CID 135314566
[4-(hydroxymethyl)-1,3-dioxolan-2-yl] formate (PubChem CID 135314566) has the molecular formula C5H8O5 and a molecular weight of 148.11 g/mol. Its IUPAC name is [4-(hydroxymethyl)-1,3-dioxolan-2-yl] formate.
| Compound Name | [4-(hydroxymethyl)-1,3-dioxolan-2-yl] formate |
|---|---|
| PubChem CID | 135314566 |
| Molecular Formula | C5H8O5 |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | [4-(hydroxymethyl)-1,3-dioxolan-2-yl] formate |
| SMILES | O=COC1OCC(CO)O1 |
| InChI | InChI=1S/C5H8O5/c6-1-4-2-8-5(10-4)9-3-7/h3-6H,1-2H2 |
| InChIKey | LTYNGLMJUQKGRJ-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|