C10H12O10 — CID 171448374
12-formyloxy-7-hydroxy-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane-4-carboxylic acid (PubChem CID 171448374) has the molecular formula C10H12O10 and a molecular weight of 292.20 g/mol. Its IUPAC name is 12-formyloxy-7-hydroxy-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane-4-carboxylic acid.
| Compound Name | 12-formyloxy-7-hydroxy-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane-4-carboxylic acid |
|---|---|
| PubChem CID | 171448374 |
| Molecular Formula | C10H12O10 |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 12-formyloxy-7-hydroxy-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane-4-carboxylic acid |
| SMILES | O=COC1OCC2OC(O)C3OC(C(=O)O)OC3C2O1 |
| InChI | InChI=1S/C10H12O10/c11-2-16-10-15-1-3-4(20-10)5-6(8(14)17-3)19-9(18-5)7(12)13/h2-6,8-10,14H,1H2,(H,12,13) |
| InChIKey | MRZPMTKBXZDLQI-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|