C10H12O9 — CID 166083230
9-methyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylic acid (PubChem CID 166083230) has the molecular formula C10H12O9 and a molecular weight of 276.20 g/mol. Its IUPAC name is 9-methyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylic acid.
| Compound Name | 9-methyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylic acid |
|---|---|
| PubChem CID | 166083230 |
| Molecular Formula | C10H12O9 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 9-methyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylic acid |
| SMILES | CC1OC(C(=O)O)OC2C1OC1OC(C(=O)O)OC12 |
| InChI | InChI=1S/C10H12O9/c1-2-3-4(17-9(15-2)6(11)12)5-8(16-3)19-10(18-5)7(13)14/h2-5,8-10H,1H3,(H,11,12)(H,13,14) |
| InChIKey | XYBGNFXKRGLMAD-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |