C20H18O7 — CID 166083279
4,11-diphenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-9-carboxylic acid (PubChem CID 166083279) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is 4,11-diphenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-9-carboxylic acid.
| Compound Name | 4,11-diphenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-9-carboxylic acid |
|---|---|
| PubChem CID | 166083279 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4,11-diphenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-9-carboxylic acid |
| SMILES | O=C(O)C1OC(c2ccccc2)OC2C3OC(c4ccccc4)OC3OC12 |
| InChI | InChI=1S/C20H18O7/c21-17(22)15-13-14(23-18(25-15)11-7-3-1-4-8-11)16-20(24-13)27-19(26-16)12-9-5-2-6-10-12/h1-10,13-16,18-20H,(H,21,22) |
| InChIKey | XZLWCODUHLYNSK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |