C19H25N3O6 — CID 134878343
N-[[(3aR,5R,6S,7S,7aR)-6,7-diacetamido-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl]acetamide (PubChem CID 134878343) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[[(3aR,5R,6S,7S,7aR)-6,7-diacetamido-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl]acetamide.
| Compound Name | N-[[(3aR,5R,6S,7S,7aR)-6,7-diacetamido-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 134878343 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[[(3aR,5R,6S,7S,7aR)-6,7-diacetamido-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1O[C@@H]2OC(c3ccccc3)O[C@@H]2[C@@H](NC(C)=O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C19H25N3O6/c1-10(23)20-9-14-15(21-11(2)24)16(22-12(3)25)17-19(26-14)28-18(27-17)13-7-5-4-6-8-13/h4-8,14-19H,9H2,1-3H3,(H,20,23)(H,21,24)(H,22,25)/t14-,15-,16+,17-,18?,19-/m1/s1 |
| InChIKey | OPAUDMAGPCGWRT-HFHYLLLSSA-N |
| XLogP | -0.03 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |