C7H12O4 — CID 123680482
3,6-dimethyl-2,5,8-trioxabicyclo[5.1.0]octan-4-ol (PubChem CID 123680482) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 3,6-dimethyl-2,5,8-trioxabicyclo[5.1.0]octan-4-ol.
| Compound Name | 3,6-dimethyl-2,5,8-trioxabicyclo[5.1.0]octan-4-ol |
|---|---|
| PubChem CID | 123680482 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3,6-dimethyl-2,5,8-trioxabicyclo[5.1.0]octan-4-ol |
| SMILES | CC1OC2OC2C(C)OC1O |
| InChI | InChI=1S/C7H12O4/c1-3-5-7(11-5)10-4(2)6(8)9-3/h3-8H,1-2H3 |
| InChIKey | ZYNDDBGNRBCNLZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|