C6H12O5 — CID 59897521
(3S,4R,5R)-6-methyloxane-2,3,4,5-tetrol (PubChem CID 59897521) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is (3S,4R,5R)-6-methyloxane-2,3,4,5-tetrol.
| Compound Name | (3S,4R,5R)-6-methyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 59897521 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (3S,4R,5R)-6-methyloxane-2,3,4,5-tetrol |
| SMILES | CC1OC(O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2?,3-,4+,5-,6?/m0/s1 |
| InChIKey | SHZGCJCMOBCMKK-CQGHMCOMSA-N |
| XLogP | -2.19 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |