C12H22O9 — CID 91854438
(2S,3R,4R,5R,6S)-2-methyl-6-[(2S,3R,4S,5R)-4,5,6-trihydroxy-2-methyloxan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 91854438) has the molecular formula C12H22O9 and a molecular weight of 310.30 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-methyl-6-[(2S,3R,4S,5R)-4,5,6-trihydroxy-2-methyloxan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6S)-2-methyl-6-[(2S,3R,4S,5R)-4,5,6-trihydroxy-2-methyloxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 91854438 |
| Molecular Formula | C12H22O9 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-methyl-6-[(2S,3R,4S,5R)-4,5,6-trihydroxy-2-methyloxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@@H](O)C(O)O[C@H]2C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O9/c1-3-5(13)6(14)9(17)12(20-3)21-10-4(2)19-11(18)8(16)7(10)15/h3-18H,1-2H3/t3-,4-,5-,6+,7-,8+,9+,10-,11?,12-/m0/s1 |
| InChIKey | CBMZDPBVDFEWRY-HPVPJUFISA-N |
| XLogP | -3.34 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |