C13H24O8 — CID 121354836
(3S,5R)-2-[(3R,5S)-4,5-dihydroxy-2,6-dimethyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol (PubChem CID 121354836) has the molecular formula C13H24O8 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3S,5R)-2-[(3R,5S)-4,5-dihydroxy-2,6-dimethyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol.
| Compound Name | (3S,5R)-2-[(3R,5S)-4,5-dihydroxy-2,6-dimethyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 121354836 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (3S,5R)-2-[(3R,5S)-4,5-dihydroxy-2,6-dimethyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES | CC1OC(C)[C@H](OC2OC(C)[C@H](O)C(O)[C@@H]2O)C(O)[C@@H]1O |
| InChI | InChI=1S/C13H24O8/c1-4-8(15)10(17)12(6(3)19-4)21-13-11(18)9(16)7(14)5(2)20-13/h4-18H,1-3H3/t4?,5?,6?,7-,8+,9?,10?,11-,12-,13?/m0/s1 |
| InChIKey | LCQHHNIAWKFQNE-GQVCFRDESA-N |
| XLogP | -2.27 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |