C12H24O10 — CID 129314639
(2R,3R,4S,5R,6R)-6-methyloxane-2,3,4,5-tetrol;(2R,3S,4R,5S,6S)-6-methyloxane-2,3,4,5-tetrol (PubChem CID 129314639) has the molecular formula C12H24O10 and a molecular weight of 328.31 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-methyloxane-2,3,4,5-tetrol;(2R,3S,4R,5S,6S)-6-methyloxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5R,6R)-6-methyloxane-2,3,4,5-tetrol;(2R,3S,4R,5S,6S)-6-methyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 129314639 |
| Molecular Formula | C12H24O10 |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-methyloxane-2,3,4,5-tetrol;(2R,3S,4R,5S,6S)-6-methyloxane-2,3,4,5-tetrol |
| SMILES | C[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O.C[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/2C6H12O5/c2*1-2-3(7)4(8)5(9)6(10)11-2/h2*2-10H,1H3/t2-,3+,4+,5-,6+;2-,3+,4+,5-,6-/m01/s1 |
| InChIKey | QVAYSKZTDXZMSM-VDLMAIQDSA-N |
| XLogP | -4.39 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |