C6H12O5 — CID 90472741
(3R,4R,5R,6S)-6-methyl(213C)oxane-2,3,4,5-tetrol (PubChem CID 90472741) has the molecular formula C6H12O5 and a molecular weight of 165.15 g/mol. Its IUPAC name is (3R,4R,5R,6S)-6-methyl(213C)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4R,5R,6S)-6-methyl(213C)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 90472741 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | (3R,4R,5R,6S)-6-methyl(213C)oxane-2,3,4,5-tetrol |
| SMILES | C[C@@H]1O[13CH](O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3-,4+,5+,6?/m0/s1/i6+1 |
| InChIKey | SHZGCJCMOBCMKK-FOESMIFPSA-N |
| XLogP | -2.19 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |