C5H10O5 — CID 163702397
6-methyl-1,3-dioxane-2,4,5-triol (PubChem CID 163702397) has the molecular formula C5H10O5 and a molecular weight of 150.13 g/mol. Its IUPAC name is 6-methyl-1,3-dioxane-2,4,5-triol.
| Compound Name | 6-methyl-1,3-dioxane-2,4,5-triol |
|---|---|
| PubChem CID | 163702397 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 6-methyl-1,3-dioxane-2,4,5-triol |
| SMILES | CC1OC(O)OC(O)C1O |
| InChI | InChI=1S/C5H10O5/c1-2-3(6)4(7)10-5(8)9-2/h2-8H,1H3 |
| InChIKey | KCDWGTRMTYWJHU-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |