C8H17NO4 — CID 130905906
(3S,4R,5R,6R)-4-(dimethylamino)-6-methyloxane-2,3,5-triol (PubChem CID 130905906) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is (3S,4R,5R,6R)-4-(dimethylamino)-6-methyloxane-2,3,5-triol.
| Compound Name | (3S,4R,5R,6R)-4-(dimethylamino)-6-methyloxane-2,3,5-triol |
|---|---|
| PubChem CID | 130905906 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | (3S,4R,5R,6R)-4-(dimethylamino)-6-methyloxane-2,3,5-triol |
| SMILES | C[C@H]1OC(O)[C@@H](O)[C@H](N(C)C)[C@H]1O |
| InChI | InChI=1S/C8H17NO4/c1-4-6(10)5(9(2)3)7(11)8(12)13-4/h4-8,10-12H,1-3H3/t4-,5-,6+,7+,8?/m1/s1 |
| InChIKey | DIOQKPOBSJVSJS-WZPXOXCRSA-N |
| XLogP | -1.62 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |