C10H21NO4 — CID 134847409
(2S,3S,4R,6R)-4-(dimethylamino)-2-ethoxy-6-methyloxane-3,5-diol (PubChem CID 134847409) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is (2S,3S,4R,6R)-4-(dimethylamino)-2-ethoxy-6-methyloxane-3,5-diol.
| Compound Name | (2S,3S,4R,6R)-4-(dimethylamino)-2-ethoxy-6-methyloxane-3,5-diol |
|---|---|
| PubChem CID | 134847409 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (2S,3S,4R,6R)-4-(dimethylamino)-2-ethoxy-6-methyloxane-3,5-diol |
| SMILES | CCO[C@H]1O[C@H](C)C(O)[C@@H](N(C)C)[C@@H]1O |
| InChI | InChI=1S/C10H21NO4/c1-5-14-10-9(13)7(11(3)4)8(12)6(2)15-10/h6-10,12-13H,5H2,1-4H3/t6-,7-,8?,9+,10+/m1/s1 |
| InChIKey | OYJVQAGPZGWAQG-JDTCHFRJSA-N |
| XLogP | -0.58 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |