C18H35NO6 — CID 118517821
(3R,4R,5S)-5-[(2S,3R,4S,5S,6R)-3,5-dimethoxy-4,6-dimethyloxan-2-yl]oxy-4-(dimethylamino)-2,6-dimethyloxan-3-ol (PubChem CID 118517821) has the molecular formula C18H35NO6 and a molecular weight of 361.48 g/mol. Its IUPAC name is (3R,4R,5S)-5-[(2S,3R,4S,5S,6R)-3,5-dimethoxy-4,6-dimethyloxan-2-yl]oxy-4-(dimethylamino)-2,6-dimethyloxan-3-ol.
| Compound Name | (3R,4R,5S)-5-[(2S,3R,4S,5S,6R)-3,5-dimethoxy-4,6-dimethyloxan-2-yl]oxy-4-(dimethylamino)-2,6-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 118517821 |
| Molecular Formula | C18H35NO6 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (3R,4R,5S)-5-[(2S,3R,4S,5S,6R)-3,5-dimethoxy-4,6-dimethyloxan-2-yl]oxy-4-(dimethylamino)-2,6-dimethyloxan-3-ol |
| SMILES | CO[C@H]1[C@H](O[C@@H]2C(C)OC(C)[C@H](O)[C@H]2N(C)C)O[C@H](C)[C@@H](OC)[C@@H]1C |
| InChI | InChI=1S/C18H35NO6/c1-9-15(21-7)11(3)24-18(16(9)22-8)25-17-12(4)23-10(2)14(20)13(17)19(5)6/h9-18,20H,1-8H3/t9-,10?,11+,12?,13+,14-,15-,16+,17+,18-/m0/s1 |
| InChIKey | OOBDJJYQNODBNU-QXBKFHAKSA-N |
| XLogP | 0.88 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |