C15H28O9 — CID 91849807
(2S,3R,4R,5S,6S)-6-[(3R,4S,5R)-2-hydroxy-3,5-dimethoxyoxan-4-yl]oxy-4,5-dimethoxy-2-methyloxan-3-ol (PubChem CID 91849807) has the molecular formula C15H28O9 and a molecular weight of 352.38 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-6-[(3R,4S,5R)-2-hydroxy-3,5-dimethoxyoxan-4-yl]oxy-4,5-dimethoxy-2-methyloxan-3-ol.
| Compound Name | (2S,3R,4R,5S,6S)-6-[(3R,4S,5R)-2-hydroxy-3,5-dimethoxyoxan-4-yl]oxy-4,5-dimethoxy-2-methyloxan-3-ol |
|---|---|
| PubChem CID | 91849807 |
| Molecular Formula | C15H28O9 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (2S,3R,4R,5S,6S)-6-[(3R,4S,5R)-2-hydroxy-3,5-dimethoxyoxan-4-yl]oxy-4,5-dimethoxy-2-methyloxan-3-ol |
| SMILES | CO[C@@H]1[C@H](O[C@H]2[C@H](OC)COC(O)[C@@H]2OC)O[C@@H](C)[C@@H](O)[C@H]1OC |
| InChI | InChI=1S/C15H28O9/c1-7-9(16)11(19-3)13(21-5)15(23-7)24-10-8(18-2)6-22-14(17)12(10)20-4/h7-17H,6H2,1-5H3/t7-,8+,9+,10-,11+,12+,13-,14?,15-/m0/s1 |
| InChIKey | TXNPDNYBFWIDBG-CAQYTPKNSA-N |
| XLogP | -1.11 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |