About 5-methoxyoxane-2,3,4-triol
5-methoxyoxane-2,3,4-triol (PubChem CID 560177) has the molecular formula C6H12O5
and a molecular weight of 164.16 g/mol. Its IUPAC name is 5-methoxyoxane-2,3,4-triol.
Molecular Properties
| Compound Name | 5-methoxyoxane-2,3,4-triol |
| PubChem CID | 560177 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 5-methoxyoxane-2,3,4-triol |
| SMILES | COC1COC(O)C(O)C1O |
| InChI | InChI=1S/C6H12O5/c1-10-3-2-11-6(9)5(8)4(3)7/h3-9H,2H2,1H3 |
| InChIKey | VDTSWFBDTKNBSS-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxyoxane-2,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyoxane-2,3,4-triol?
The IUPAC name of 5-methoxyoxane-2,3,4-triol (CID 560177) is 5-methoxyoxane-2,3,4-triol.
What is the SMILES notation for 5-methoxyoxane-2,3,4-triol?
The canonical SMILES for 5-methoxyoxane-2,3,4-triol is COC1COC(O)C(O)C1O.
What is the InChIKey of 5-methoxyoxane-2,3,4-triol?
The InChIKey is VDTSWFBDTKNBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O5/c1-10-3-2-11-6(9)5(8)4(3)7/h3-9H,2H2,1H3.
What are the key properties of 5-methoxyoxane-2,3,4-triol?
5-methoxyoxane-2,3,4-triol has a molecular weight of 164.16 g/mol, XLogP of -1.93, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyoxane-2,3,4-triol is sourced from PubChem (CID 560177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).