C10H19NO7 — CID 101204736
tert-butyl N-[(3R,4S,5S)-4,5,6-trihydroxyoxan-3-yl]oxycarbamate (PubChem CID 101204736) has the molecular formula C10H19NO7 and a molecular weight of 265.26 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S,5S)-4,5,6-trihydroxyoxan-3-yl]oxycarbamate.
| Compound Name | tert-butyl N-[(3R,4S,5S)-4,5,6-trihydroxyoxan-3-yl]oxycarbamate |
|---|---|
| PubChem CID | 101204736 |
| Molecular Formula | C10H19NO7 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | tert-butyl N-[(3R,4S,5S)-4,5,6-trihydroxyoxan-3-yl]oxycarbamate |
| SMILES | CC(C)(C)OC(=O)NO[C@@H]1COC(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H19NO7/c1-10(2,3)17-9(15)11-18-5-4-16-8(14)7(13)6(5)12/h5-8,12-14H,4H2,1-3H3,(H,11,15)/t5-,6-,7+,8?/m1/s1 |
| InChIKey | NBQQSRSGTRLODD-HBFKVTOISA-N |
| XLogP | -1.12 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|