C9H19NO4 — CID 10845899
tert-butyl N-(1-hydroxy-2-methylpropan-2-yl)oxycarbamate (PubChem CID 10845899) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is tert-butyl N-(1-hydroxy-2-methylpropan-2-yl)oxycarbamate.
| Compound Name | tert-butyl N-(1-hydroxy-2-methylpropan-2-yl)oxycarbamate |
|---|---|
| PubChem CID | 10845899 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | tert-butyl N-(1-hydroxy-2-methylpropan-2-yl)oxycarbamate |
| SMILES | CC(C)(C)OC(=O)NOC(C)(C)CO |
| InChI | InChI=1S/C9H19NO4/c1-8(2,3)13-7(12)10-14-9(4,5)6-11/h11H,6H2,1-5H3,(H,10,12) |
| InChIKey | ZOGLEOIAQNHQHA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|