About [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride
[(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride (PubChem CID 23087927) has the molecular formula C8H16ClNO4
and a molecular weight of 225.67 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride.
Molecular Properties
| Compound Name | [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride |
| PubChem CID | 23087927 |
| Molecular Formula | C8H16ClNO4 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride |
| SMILES | CCC(=O)ONC(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C8H15NO4.ClH/c1-5-6(10)13-9-7(11)12-8(2,3)4;/h5H2,1-4H3,(H,9,11);1H |
| InChIKey | GGPKHJVKYYTECS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride?
The IUPAC name of [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride (CID 23087927) is [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride.
What is the SMILES notation for [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride?
The canonical SMILES for [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride is CCC(=O)ONC(=O)OC(C)(C)C.Cl.
What is the InChIKey of [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride?
The InChIKey is GGPKHJVKYYTECS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4.ClH/c1-5-6(10)13-9-7(11)12-8(2,3)4;/h5H2,1-4H3,(H,9,11);1H.
What are the key properties of [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride?
[(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride has a molecular weight of 225.67 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-methylpropan-2-yl)oxycarbonylamino] propanoate;hydrochloride is sourced from PubChem (CID 23087927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).