C13H23ClN2O6 — CID 10893135
[(2-methylpropan-2-yl)oxycarbonylamino] (2R)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 10893135) has the molecular formula C13H23ClN2O6 and a molecular weight of 338.79 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonylamino] (2R)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [(2-methylpropan-2-yl)oxycarbonylamino] (2R)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 10893135 |
| Molecular Formula | C13H23ClN2O6 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonylamino] (2R)-3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NOC(=O)[C@H](CCl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23ClN2O6/c1-12(2,3)20-10(18)15-8(7-14)9(17)22-16-11(19)21-13(4,5)6/h8H,7H2,1-6H3,(H,15,18)(H,16,19)/t8-/m0/s1 |
| InChIKey | UAWMCYOCRVTMSG-QMMMGPOBSA-N |
| XLogP | 2.10 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|