C12H19Cl2NO5 — CID 161138429
(2R,5R)-6-chloro-2-(chloromethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoic acid (PubChem CID 161138429) has the molecular formula C12H19Cl2NO5 and a molecular weight of 328.19 g/mol. Its IUPAC name is (2R,5R)-6-chloro-2-(chloromethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoic acid.
| Compound Name | (2R,5R)-6-chloro-2-(chloromethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoic acid |
|---|---|
| PubChem CID | 161138429 |
| Molecular Formula | C12H19Cl2NO5 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (2R,5R)-6-chloro-2-(chloromethyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCl)C(=O)C[C@@H](CCl)C(=O)O |
| InChI | InChI=1S/C12H19Cl2NO5/c1-12(2,3)20-11(19)15-8(6-14)9(16)4-7(5-13)10(17)18/h7-8H,4-6H2,1-3H3,(H,15,19)(H,17,18)/t7-,8-/m0/s1 |
| InChIKey | UNCMNEZSBXEKRS-YUMQZZPRSA-N |
| XLogP | 2.02 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|