C13H24Cl2N2O5 — CID 144923624
(2R)-3-chloro-2-[[3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid;ethane (PubChem CID 144923624) has the molecular formula C13H24Cl2N2O5 and a molecular weight of 359.25 g/mol. Its IUPAC name is (2R)-3-chloro-2-[[3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid;ethane.
| Compound Name | (2R)-3-chloro-2-[[3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid;ethane |
|---|---|
| PubChem CID | 144923624 |
| Molecular Formula | C13H24Cl2N2O5 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (2R)-3-chloro-2-[[3-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NC(CCl)C(=O)N[C@@H](CCl)C(=O)O |
| InChI | InChI=1S/C11H18Cl2N2O5.C2H6/c1-11(2,3)20-10(19)15-6(4-12)8(16)14-7(5-13)9(17)18;1-2/h6-7H,4-5H2,1-3H3,(H,14,16)(H,15,19)(H,17,18);1-2H3/t6?,7-;/m0./s1 |
| InChIKey | OIURXTPEVDQSAW-JWOPXBRZSA-N |
| XLogP | 1.95 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|