C11H21ClN2O4 — CID 165439685
chloromethyl 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 165439685) has the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. Its IUPAC name is chloromethyl 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | chloromethyl 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 165439685 |
| Molecular Formula | C11H21ClN2O4 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | chloromethyl 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CN(C)CC(NC(=O)OC(C)(C)C)C(=O)OCCl |
| InChI | InChI=1S/C11H21ClN2O4/c1-11(2,3)18-10(16)13-8(6-14(4)5)9(15)17-7-12/h8H,6-7H2,1-5H3,(H,13,16) |
| InChIKey | FWBPUFXHJLWHMH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|