C12H18ClN3O4 — CID 165439876
chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1H-pyrazol-5-yl)propanoate (PubChem CID 165439876) has the molecular formula C12H18ClN3O4 and a molecular weight of 303.75 g/mol. Its IUPAC name is chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1H-pyrazol-5-yl)propanoate.
| Compound Name | chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1H-pyrazol-5-yl)propanoate |
|---|---|
| PubChem CID | 165439876 |
| Molecular Formula | C12H18ClN3O4 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | chloromethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1H-pyrazol-5-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccn[nH]1)C(=O)OCCl |
| InChI | InChI=1S/C12H18ClN3O4/c1-12(2,3)20-11(18)15-9(10(17)19-7-13)6-8-4-5-14-16-8/h4-5,9H,6-7H2,1-3H3,(H,14,16)(H,15,18) |
| InChIKey | RYBGIBZFFLITLX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|