C14H23N3O3 — CID 81003264
tert-butyl (2R)-3-methyl-2-[[2-(1H-pyrazol-5-yl)acetyl]amino]butanoate (PubChem CID 81003264) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is tert-butyl (2R)-3-methyl-2-[[2-(1H-pyrazol-5-yl)acetyl]amino]butanoate.
| Compound Name | tert-butyl (2R)-3-methyl-2-[[2-(1H-pyrazol-5-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 81003264 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | tert-butyl (2R)-3-methyl-2-[[2-(1H-pyrazol-5-yl)acetyl]amino]butanoate |
| SMILES | CC(C)[C@@H](NC(=O)Cc1ccn[nH]1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23N3O3/c1-9(2)12(13(19)20-14(3,4)5)16-11(18)8-10-6-7-15-17-10/h6-7,9,12H,8H2,1-5H3,(H,15,17)(H,16,18)/t12-/m1/s1 |
| InChIKey | SJBBXWGWEWFEJK-GFCCVEGCSA-N |
| XLogP | 1.43 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |